| English name: | 2,5-Dimethoxytetrahydrofuran, mixture of cis- and trans isomers | |
| CAS NO: | 696-59-3 | |
| Molecular weight: | 132.1577 | |
| EC NO: | 211-797-1 | |
| Molecular formula: | C6H12O3 | |
| content: | ≥95% | |
| Water: | ≤2.0% | |
| InChI: | InChI=1/C6H12O3/c1-7-5-3-4-6(8-2)9-5/h5-6H,3-4H2,1-2H3/t5-,6+ | |
| Structure: |  |
|
| Last text：Cyclohexanol | Next text： Diethyl aminomalonate hydrochloride |
Add: Luohe City Chemical Park, Luohe, Henan, China.
P.C.: 462000
Contact: Zhang Jianwei +86-13903953077
Tel: +86-395-7133188 Fax: +86-395-7135789
Website: www.cqcdmy.com E-mail: sales@meidikangchem.com
Luohe Meidikang Biological Technology Co.,Ltd. Copyright(C)2017 All Rights Reserved. Supported
ChemNet
ChinaChemNet
Toocle
Copyright Notice